C7H7IN6O2 — CID 178130242
N-(iodomethyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 178130242) has the molecular formula C7H7IN6O2 and a molecular weight of 334.08 g/mol. Its IUPAC name is N-(iodomethyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | N-(iodomethyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 178130242 |
| Molecular Formula | C7H7IN6O2 |
| Molecular Weight | 334.08 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | N-(iodomethyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | Cn1nnc2c(C(=O)NCI)ncn2c1=O |
| InChI | InChI=1S/C7H7IN6O2/c1-13-7(16)14-3-10-4(5(14)11-12-13)6(15)9-2-8/h3H,2H2,1H3,(H,9,15) |
| InChIKey | FGEMOFZCTRANEC-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.08 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|