About ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine
ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine (PubChem CID 145138835) has the molecular formula C27H60N4O
and a molecular weight of 456.80 g/mol. Its IUPAC name is ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine.
Molecular Properties
| Compound Name | ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine |
| PubChem CID | 145138835 |
| Molecular Formula | C27H60N4O |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.48 |
| IUPAC Name | ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine |
| SMILES | CC.CC.CC.CN1CCC(N2CCCCC2)CC1.CN1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C11H22N2.C10H20N2O.3C2H6/c1-12-9-5-11(6-10-12)13-7-3-2-4-8-13;1-11-4-2-10(3-5-11)12-6-8-13-9-7-12;3*1-2/h11H,2-10H2,1H3;10H,2-9H2,1H3;3*1-2H3 |
| InChIKey | MHRJOQCYCDVFQU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine?
The IUPAC name of ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine (CID 145138835) is ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine.
What is the SMILES notation for ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine?
The canonical SMILES for ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine is CC.CC.CC.CN1CCC(N2CCCCC2)CC1.CN1CCC(N2CCOCC2)CC1.
What is the InChIKey of ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine?
The InChIKey is MHRJOQCYCDVFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.C10H20N2O.3C2H6/c1-12-9-5-11(6-10-12)13-7-3-2-4-8-13;1-11-4-2-10(3-5-11)12-6-8-13-9-7-12;3*1-2/h11H,2-10H2,1H3;10H,2-9H2,1H3;3*1-2H3.
What are the key properties of ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine?
ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine has a molecular weight of 456.80 g/mol, XLogP of 5.06, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(1-methylpiperidin-4-yl)morpholine;1-methyl-4-piperidin-1-ylpiperidine is sourced from PubChem (CID 145138835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).