C20H35N5O5S — CID 145139213
4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]benzamide;ethane;propan-1-ol (PubChem CID 145139213) has the molecular formula C20H35N5O5S and a molecular weight of 457.60 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]benzamide;ethane;propan-1-ol.
| Compound Name | 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]benzamide;ethane;propan-1-ol |
|---|---|
| PubChem CID | 145139213 |
| Molecular Formula | C20H35N5O5S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]benzamide;ethane;propan-1-ol |
| SMILES | CC.CCCO.N/C=C\N(N)c1ccc(C(=O)NCC(=O)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C15H21N5O4S.C3H8O.C2H6/c16-5-6-20(17)13-3-1-12(2-4-13)15(22)18-11-14(21)19-7-9-25(23,24)10-8-19;1-2-3-4;1-2/h1-6H,7-11,16-17H2,(H,18,22);4H,2-3H2,1H3;1-2H3/b6-5-;; |
| InChIKey | OSJZRTCMEGATMH-XNOMRPDFSA-N |
| XLogP | 0.20 |
| TPSA | 159.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|