C16H24N6O2 — CID 145139086
4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-[3-(dimethylamino)azetidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 145139086) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-[3-(dimethylamino)azetidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-[3-(dimethylamino)azetidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 145139086 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[2-[3-(dimethylamino)azetidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CN(C)C1CN(C(=O)CNC(=O)c2ccc(N(N)/C=C\N)cc2)C1 |
| InChI | InChI=1S/C16H24N6O2/c1-20(2)14-10-21(11-14)15(23)9-19-16(24)12-3-5-13(6-4-12)22(18)8-7-17/h3-8,14H,9-11,17-18H2,1-2H3,(H,19,24)/b8-7- |
| InChIKey | LXCUOXGMIWRWON-FPLPWBNLSA-N |
| XLogP | -0.70 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|