About CID 145139332
CID 145139332 (PubChem CID 145139332) has the molecular formula C20H19NOSi-
and a molecular weight of 317.46 g/mol.
Molecular Properties
| Compound Name | CID 145139332 |
| PubChem CID | 145139332 |
| Molecular Formula | C20H19NOSi- |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | — |
| SMILES | C[Si-](C)(C)C#Cc1ccc2cccc(Oc3ccccc3)c2n1 |
| InChI | InChI=1S/C20H19NOSi/c1-23(2,3)15-14-17-13-12-16-8-7-11-19(20(16)21-17)22-18-9-5-4-6-10-18/h4-13H,1-3H3/q-1 |
| InChIKey | KDDMHRCOZLCOBW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 145139332 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145139332?
The IUPAC name of CID 145139332 (CID 145139332) is not available.
What is the SMILES notation for CID 145139332?
The canonical SMILES for CID 145139332 is C[Si-](C)(C)C#Cc1ccc2cccc(Oc3ccccc3)c2n1.
What is the InChIKey of CID 145139332?
The InChIKey is KDDMHRCOZLCOBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NOSi/c1-23(2,3)15-14-17-13-12-16-8-7-11-19(20(16)21-17)22-18-9-5-4-6-10-18/h4-13H,1-3H3/q-1.
What are the key properties of CID 145139332?
CID 145139332 has a molecular weight of 317.46 g/mol, XLogP of 5.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145139332 is sourced from PubChem (CID 145139332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).