About ethane;1-methylpyrazole-3-sulfonyl chloride
ethane;1-methylpyrazole-3-sulfonyl chloride (PubChem CID 145139653) has the molecular formula C6H11ClN2O2S
and a molecular weight of 210.69 g/mol. Its IUPAC name is ethane;1-methylpyrazole-3-sulfonyl chloride.
Molecular Properties
| Compound Name | ethane;1-methylpyrazole-3-sulfonyl chloride |
| PubChem CID | 145139653 |
| Molecular Formula | C6H11ClN2O2S |
| Molecular Weight | 210.69 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | ethane;1-methylpyrazole-3-sulfonyl chloride |
| SMILES | CC.Cn1ccc(S(=O)(=O)Cl)n1 |
| InChI | InChI=1S/C4H5ClN2O2S.C2H6/c1-7-3-2-4(6-7)10(5,8)9;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | XNSSDLICHDLHRI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methylpyrazole-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylpyrazole-3-sulfonyl chloride?
The IUPAC name of ethane;1-methylpyrazole-3-sulfonyl chloride (CID 145139653) is ethane;1-methylpyrazole-3-sulfonyl chloride.
What is the SMILES notation for ethane;1-methylpyrazole-3-sulfonyl chloride?
The canonical SMILES for ethane;1-methylpyrazole-3-sulfonyl chloride is CC.Cn1ccc(S(=O)(=O)Cl)n1.
What is the InChIKey of ethane;1-methylpyrazole-3-sulfonyl chloride?
The InChIKey is XNSSDLICHDLHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2O2S.C2H6/c1-7-3-2-4(6-7)10(5,8)9;1-2/h2-3H,1H3;1-2H3.
What are the key properties of ethane;1-methylpyrazole-3-sulfonyl chloride?
ethane;1-methylpyrazole-3-sulfonyl chloride has a molecular weight of 210.69 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylpyrazole-3-sulfonyl chloride is sourced from PubChem (CID 145139653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).