C20H21N3OS — CID 145141589
5-(3,4-dimethylphenyl)-3-(2-imino-4-methylpent-3-enyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 145141589) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-3-(2-imino-4-methylpent-3-enyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3,4-dimethylphenyl)-3-(2-imino-4-methylpent-3-enyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145141589 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-3-(2-imino-4-methylpent-3-enyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | [H]/N=C(\C=C(C)C)Cn1cnc2scc(-c3ccc(C)c(C)c3)c2c1=O |
| InChI | InChI=1S/C20H21N3OS/c1-12(2)7-16(21)9-23-11-22-19-18(20(23)24)17(10-25-19)15-6-5-13(3)14(4)8-15/h5-8,10-11,21H,9H2,1-4H3/b21-16+ |
| InChIKey | BISFYJHLYGSDFT-LTGZKZEYSA-N |
| XLogP | 4.73 |
| TPSA | 58.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|