C25H35N3O2S — CID 14514291
3-[2-[3-(diethylamino)phenoxy]ethylamino]-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)propan-1-one (PubChem CID 14514291) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is 3-[2-[3-(diethylamino)phenoxy]ethylamino]-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)propan-1-one.
| Compound Name | 3-[2-[3-(diethylamino)phenoxy]ethylamino]-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)propan-1-one |
|---|---|
| PubChem CID | 14514291 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-[2-[3-(diethylamino)phenoxy]ethylamino]-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)propan-1-one |
| SMILES | CCN(CC)c1cccc(OCCNCCC(=O)N2CCC(C)Sc3ccccc32)c1 |
| InChI | InChI=1S/C25H35N3O2S/c1-4-27(5-2)21-9-8-10-22(19-21)30-18-16-26-15-13-25(29)28-17-14-20(3)31-24-12-7-6-11-23(24)28/h6-12,19-20,26H,4-5,13-18H2,1-3H3 |
| InChIKey | OFEFAPWGPCGBQQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|