C19H21N3O4S — CID 145143425
(3R)-3-[2-[3-[4-[amino(hydroxy)methyl]-5-(methoxymethyl)-1,3-thiazol-2-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 145143425) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is (3R)-3-[2-[3-[4-[amino(hydroxy)methyl]-5-(methoxymethyl)-1,3-thiazol-2-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-[2-[3-[4-[amino(hydroxy)methyl]-5-(methoxymethyl)-1,3-thiazol-2-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 145143425 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (3R)-3-[2-[3-[4-[amino(hydroxy)methyl]-5-(methoxymethyl)-1,3-thiazol-2-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | COCc1sc(-c2cccc(C#C[C@]3(O)CCN(C)C3=O)c2)nc1C(N)O |
| InChI | InChI=1S/C19H21N3O4S/c1-22-9-8-19(25,18(22)24)7-6-12-4-3-5-13(10-12)17-21-15(16(20)23)14(27-17)11-26-2/h3-5,10,16,23,25H,8-9,11,20H2,1-2H3/t16?,19-/m0/s1 |
| InChIKey | OSQIQGPVZHEDGR-CVMIBEPCSA-N |
| XLogP | 0.85 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|