C22H19N3O2 — CID 155340546
3-[2-[3-(1-aminoisoquinolin-7-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 155340546) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[2-[3-(1-aminoisoquinolin-7-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 3-[2-[3-(1-aminoisoquinolin-7-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 155340546 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-[2-[3-(1-aminoisoquinolin-7-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(O)(C#Cc2cccc(-c3ccc4ccnc(N)c4c3)c2)C1=O |
| InChI | InChI=1S/C22H19N3O2/c1-25-12-10-22(27,21(25)26)9-7-15-3-2-4-17(13-15)18-6-5-16-8-11-24-20(23)19(16)14-18/h2-6,8,11,13-14,27H,10,12H2,1H3,(H2,23,24) |
| InChIKey | XDJJZWXCULKACJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|