C23H21N3O2 — CID 155340279
(3S)-3-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-3-hydroxy-1-(trideuteriomethyl)pyrrolidin-2-one (PubChem CID 155340279) has the molecular formula C23H21N3O2 and a molecular weight of 374.46 g/mol. Its IUPAC name is (3S)-3-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-3-hydroxy-1-(trideuteriomethyl)pyrrolidin-2-one.
| Compound Name | (3S)-3-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-3-hydroxy-1-(trideuteriomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 155340279 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (3S)-3-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-3-hydroxy-1-(trideuteriomethyl)pyrrolidin-2-one |
| SMILES | [2H]C([2H])([2H])N1CC[C@](O)(C#Cc2ccc(C)c(-c3ccc4ccnc(N)c4c3)c2)C1=O |
| InChI | InChI=1S/C23H21N3O2/c1-15-3-4-16(7-9-23(28)10-12-26(2)22(23)27)13-19(15)18-6-5-17-8-11-25-21(24)20(17)14-18/h3-6,8,11,13-14,28H,10,12H2,1-2H3,(H2,24,25)/t23-/m1/s1/i2D3 |
| InChIKey | OLNIYHYTHKDLLI-ZHBYIVLDSA-N |
| XLogP | 2.74 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|