C24H21N3O — CID 155364023
7-[2-methyl-5-[(3S)-3-(5-methyl-1,2-oxazol-3-yl)but-1-ynyl]phenyl]isoquinolin-1-amine (PubChem CID 155364023) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 7-[2-methyl-5-[(3S)-3-(5-methyl-1,2-oxazol-3-yl)but-1-ynyl]phenyl]isoquinolin-1-amine.
| Compound Name | 7-[2-methyl-5-[(3S)-3-(5-methyl-1,2-oxazol-3-yl)but-1-ynyl]phenyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 155364023 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 7-[2-methyl-5-[(3S)-3-(5-methyl-1,2-oxazol-3-yl)but-1-ynyl]phenyl]isoquinolin-1-amine |
| SMILES | Cc1cc([C@@H](C)C#Cc2ccc(C)c(-c3ccc4ccnc(N)c4c3)c2)no1 |
| InChI | InChI=1S/C24H21N3O/c1-15-4-6-18(7-5-16(2)23-12-17(3)28-27-23)13-21(15)20-9-8-19-10-11-26-24(25)22(19)14-20/h4,6,8-14,16H,1-3H3,(H2,25,26)/t16-/m0/s1 |
| InChIKey | JIEIXGNUNISMQD-INIZCTEOSA-N |
| XLogP | 5.24 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|