About 1-aminoisoquinoline-7-carbonitrile;pentane
1-aminoisoquinoline-7-carbonitrile;pentane (PubChem CID 178040061) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-aminoisoquinoline-7-carbonitrile;pentane.
Molecular Properties
| Compound Name | 1-aminoisoquinoline-7-carbonitrile;pentane |
| PubChem CID | 178040061 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-aminoisoquinoline-7-carbonitrile;pentane |
| SMILES | CCCCC.N#Cc1ccc2ccnc(N)c2c1 |
| InChI | InChI=1S/C10H7N3.C5H12/c11-6-7-1-2-8-3-4-13-10(12)9(8)5-7;1-3-5-4-2/h1-5H,(H2,12,13);3-5H2,1-2H3 |
| InChIKey | BMKNMQBVFKKXQC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-aminoisoquinoline-7-carbonitrile;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoisoquinoline-7-carbonitrile;pentane?
The IUPAC name of 1-aminoisoquinoline-7-carbonitrile;pentane (CID 178040061) is 1-aminoisoquinoline-7-carbonitrile;pentane.
What is the SMILES notation for 1-aminoisoquinoline-7-carbonitrile;pentane?
The canonical SMILES for 1-aminoisoquinoline-7-carbonitrile;pentane is CCCCC.N#Cc1ccc2ccnc(N)c2c1.
What is the InChIKey of 1-aminoisoquinoline-7-carbonitrile;pentane?
The InChIKey is BMKNMQBVFKKXQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3.C5H12/c11-6-7-1-2-8-3-4-13-10(12)9(8)5-7;1-3-5-4-2/h1-5H,(H2,12,13);3-5H2,1-2H3.
What are the key properties of 1-aminoisoquinoline-7-carbonitrile;pentane?
1-aminoisoquinoline-7-carbonitrile;pentane has a molecular weight of 241.34 g/mol, XLogP of 3.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoisoquinoline-7-carbonitrile;pentane is sourced from PubChem (CID 178040061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).