About butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine
butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine (PubChem CID 145145583) has the molecular formula C16H34N2O
and a molecular weight of 270.46 g/mol. Its IUPAC name is butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine |
| PubChem CID | 145145583 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine |
| SMILES | CC(C1CCN(C)CC1)N1CCOCC1.CCCC |
| InChI | InChI=1S/C12H24N2O.C4H10/c1-11(14-7-9-15-10-8-14)12-3-5-13(2)6-4-12;1-3-4-2/h11-12H,3-10H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | JHZMZCUZGGHTOV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine?
The IUPAC name of butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine (CID 145145583) is butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine.
What is the SMILES notation for butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine?
The canonical SMILES for butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine is CC(C1CCN(C)CC1)N1CCOCC1.CCCC.
What is the InChIKey of butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine?
The InChIKey is JHZMZCUZGGHTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O.C4H10/c1-11(14-7-9-15-10-8-14)12-3-5-13(2)6-4-12;1-3-4-2/h11-12H,3-10H2,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine?
butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine has a molecular weight of 270.46 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;4-[1-(1-methylpiperidin-4-yl)ethyl]morpholine is sourced from PubChem (CID 145145583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).