C13H13N3OS — CID 1451458
3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)but-2-enamide (PubChem CID 1451458) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)but-2-enamide.
| Compound Name | 3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 1451458 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)but-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C13H13N3OS/c1-9(2)8-11(17)14-13-16-15-12(18-13)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,14,16,17) |
| InChIKey | KBAIWYFPPXNPDY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|