C13H21NO — CID 145145811
1-cyclohexa-1,5-dien-1-yl-3-ethoxypiperidine (PubChem CID 145145811) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-3-ethoxypiperidine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-3-ethoxypiperidine |
|---|---|
| PubChem CID | 145145811 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-3-ethoxypiperidine |
| SMILES | CCOC1CCCN(C2=CCCC=C2)C1 |
| InChI | InChI=1S/C13H21NO/c1-2-15-13-9-6-10-14(11-13)12-7-4-3-5-8-12/h4,7-8,13H,2-3,5-6,9-11H2,1H3 |
| InChIKey | LSATWCGGIUWFNB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |