C20H24F4N2O3 — CID 145146002
ethane;N-[2-[4-ethyl-6-(4-fluorophenyl)-5-methoxy-2-pyridinyl]-3,3,3-trifluoro-2-hydroxypropyl]formamide (PubChem CID 145146002) has the molecular formula C20H24F4N2O3 and a molecular weight of 416.42 g/mol. Its IUPAC name is ethane;N-[2-[4-ethyl-6-(4-fluorophenyl)-5-methoxy-2-pyridinyl]-3,3,3-trifluoro-2-hydroxypropyl]formamide.
| Compound Name | ethane;N-[2-[4-ethyl-6-(4-fluorophenyl)-5-methoxy-2-pyridinyl]-3,3,3-trifluoro-2-hydroxypropyl]formamide |
|---|---|
| PubChem CID | 145146002 |
| Molecular Formula | C20H24F4N2O3 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | ethane;N-[2-[4-ethyl-6-(4-fluorophenyl)-5-methoxy-2-pyridinyl]-3,3,3-trifluoro-2-hydroxypropyl]formamide |
| SMILES | CC.CCc1cc(C(O)(CNC=O)C(F)(F)F)nc(-c2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C18H18F4N2O3.C2H6/c1-3-11-8-14(17(26,9-23-10-25)18(20,21)22)24-15(16(11)27-2)12-4-6-13(19)7-5-12;1-2/h4-8,10,26H,3,9H2,1-2H3,(H,23,25);1-2H3 |
| InChIKey | NHRRNQRSNGSIES-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|