C35H35N7O6S2 — CID 145146632
tert-butyl 5-[[5-[3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanylamino]phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate (PubChem CID 145146632) has the molecular formula C35H35N7O6S2 and a molecular weight of 713.84 g/mol. Its IUPAC name is tert-butyl 5-[[5-[3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanylamino]phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[5-[3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanylamino]phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 145146632 |
| Molecular Formula | C35H35N7O6S2 |
| Molecular Weight | 713.84 g/mol |
| Exact Mass | 713.21 |
| IUPAC Name | tert-butyl 5-[[5-[3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanylamino]phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc2c(cnn2C(=O)OC(C)(C)C)c1)c1nnc(-c2cccc(NSCCN3C(=O)c4ccccc4C3=O)c2)s1 |
| InChI | InChI=1S/C35H35N7O6S2/c1-34(2,3)47-32(45)41(24-14-15-27-22(19-24)20-36-42(27)33(46)48-35(4,5)6)31-38-37-28(50-31)21-10-9-11-23(18-21)39-49-17-16-40-29(43)25-12-7-8-13-26(25)30(40)44/h7-15,18-20,39H,16-17H2,1-6H3 |
| InChIKey | VIKYOQRVPGJZGT-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.84 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|