About ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid
ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid (PubChem CID 145147292) has the molecular formula C15H22FNO3
and a molecular weight of 283.34 g/mol. Its IUPAC name is ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid |
| PubChem CID | 145147292 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid |
| SMILES | CC.CCn1c(C)cc2c(F)c(OC)ccc21.O=CO |
| InChI | InChI=1S/C12H14FNO.C2H6.CH2O2/c1-4-14-8(2)7-9-10(14)5-6-11(15-3)12(9)13;1-2;2-1-3/h5-7H,4H2,1-3H3;1-2H3;1H,(H,2,3) |
| InChIKey | NWLJWZOXDBUVMM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid?
The IUPAC name of ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid (CID 145147292) is ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid.
What is the SMILES notation for ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid?
The canonical SMILES for ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid is CC.CCn1c(C)cc2c(F)c(OC)ccc21.O=CO.
What is the InChIKey of ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid?
The InChIKey is NWLJWZOXDBUVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO.C2H6.CH2O2/c1-4-14-8(2)7-9-10(14)5-6-11(15-3)12(9)13;1-2;2-1-3/h5-7H,4H2,1-3H3;1-2H3;1H,(H,2,3).
What are the key properties of ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid?
ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid has a molecular weight of 283.34 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-fluoro-5-methoxy-2-methylindole;formic acid is sourced from PubChem (CID 145147292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).