C13H13BrF2O4 — CID 66895207
ethyl (Z)-4-bromo-3-(2,6-difluoro-3-methoxyphenoxy)but-2-enoate (PubChem CID 66895207) has the molecular formula C13H13BrF2O4 and a molecular weight of 351.14 g/mol. Its IUPAC name is ethyl (Z)-4-bromo-3-(2,6-difluoro-3-methoxyphenoxy)but-2-enoate.
| Compound Name | ethyl (Z)-4-bromo-3-(2,6-difluoro-3-methoxyphenoxy)but-2-enoate |
|---|---|
| PubChem CID | 66895207 |
| Molecular Formula | C13H13BrF2O4 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | ethyl (Z)-4-bromo-3-(2,6-difluoro-3-methoxyphenoxy)but-2-enoate |
| SMILES | CCOC(=O)/C=C(/CBr)Oc1c(F)ccc(OC)c1F |
| InChI | InChI=1S/C13H13BrF2O4/c1-3-19-11(17)6-8(7-14)20-13-9(15)4-5-10(18-2)12(13)16/h4-6H,3,7H2,1-2H3/b8-6- |
| InChIKey | VHKGGGNUOOQYNG-VURMDHGXSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|