C12H11BrF2O3 — CID 121003530
ethyl (E)-4-bromo-3-(2,4-difluorophenoxy)but-2-enoate (PubChem CID 121003530) has the molecular formula C12H11BrF2O3 and a molecular weight of 321.12 g/mol. Its IUPAC name is ethyl (E)-4-bromo-3-(2,4-difluorophenoxy)but-2-enoate.
| Compound Name | ethyl (E)-4-bromo-3-(2,4-difluorophenoxy)but-2-enoate |
|---|---|
| PubChem CID | 121003530 |
| Molecular Formula | C12H11BrF2O3 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | ethyl (E)-4-bromo-3-(2,4-difluorophenoxy)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\CBr)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H11BrF2O3/c1-2-17-12(16)6-9(7-13)18-11-4-3-8(14)5-10(11)15/h3-6H,2,7H2,1H3/b9-6+ |
| InChIKey | QYGNDSYIPFJXLU-RMKNXTFCSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|