C14H24N2 — CID 145148851
N-[1-(3,4-dihydropyridin-2-yl)ethenyl]prop-2-en-1-imine;ethane (PubChem CID 145148851) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-[1-(3,4-dihydropyridin-2-yl)ethenyl]prop-2-en-1-imine;ethane.
| Compound Name | N-[1-(3,4-dihydropyridin-2-yl)ethenyl]prop-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 145148851 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-[1-(3,4-dihydropyridin-2-yl)ethenyl]prop-2-en-1-imine;ethane |
| SMILES | C=C/C=N/C(=C)C1=NC=CCC1.CC.CC |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-3-7-11-9(2)10-6-4-5-8-12-10;2*1-2/h3,5,7-8H,1-2,4,6H2;2*1-2H3/b11-7+;; |
| InChIKey | XJBPEOWTEPNKPT-FCVAESPPSA-N |
| XLogP | 4.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|