C10H15N2+ — CID 123385926
methyl-(6-methylidene-3,4-dihydropyridin-5-ylidene)-prop-1-enylazanium (PubChem CID 123385926) has the molecular formula C10H15N2+ and a molecular weight of 163.24 g/mol. Its IUPAC name is methyl-(6-methylidene-3,4-dihydropyridin-5-ylidene)-prop-1-enylazanium.
| Compound Name | methyl-(6-methylidene-3,4-dihydropyridin-5-ylidene)-prop-1-enylazanium |
|---|---|
| PubChem CID | 123385926 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | methyl-(6-methylidene-3,4-dihydropyridin-5-ylidene)-prop-1-enylazanium |
| SMILES | C=C1N=CCC/C1=[N+](/C)C=CC |
| InChI | InChI=1S/C10H15N2/c1-4-8-12(3)10-6-5-7-11-9(10)2/h4,7-8H,2,5-6H2,1,3H3/q+1/b8-4?,12-10+ |
| InChIKey | GNUVJKTUOYOAIC-MJJPSXCHSA-N |
| XLogP | 1.98 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|