C13H22N2 — CID 143157754
N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine;ethane;prop-1-ene (PubChem CID 143157754) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine;ethane;prop-1-ene.
| Compound Name | N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143157754 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine;ethane;prop-1-ene |
| SMILES | C=CC.C=NC(=C)C1=NC=CCC1.CC |
| InChI | InChI=1S/C8H10N2.C3H6.C2H6/c1-7(9-2)8-5-3-4-6-10-8;1-3-2;1-2/h4,6H,1-3,5H2;3H,1H2,2H3;1-2H3 |
| InChIKey | DISGTNJRSHTGOO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|