C12H20N2 — CID 142569943
ethane;N-[(Z)-2-(methylideneamino)prop-1-enyl]hexa-1,5-dien-3-imine (PubChem CID 142569943) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;N-[(Z)-2-(methylideneamino)prop-1-enyl]hexa-1,5-dien-3-imine.
| Compound Name | ethane;N-[(Z)-2-(methylideneamino)prop-1-enyl]hexa-1,5-dien-3-imine |
|---|---|
| PubChem CID | 142569943 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;N-[(Z)-2-(methylideneamino)prop-1-enyl]hexa-1,5-dien-3-imine |
| SMILES | C=CC/C(C=C)=N/C=C(/C)N=C.CC |
| InChI | InChI=1S/C10H14N2.C2H6/c1-5-7-10(6-2)12-8-9(3)11-4;1-2/h5-6,8H,1-2,4,7H2,3H3;1-2H3/b9-8-,12-10+; |
| InChIKey | VIOVAQDOIBNYJH-ZTEDHSSBSA-N |
| XLogP | 3.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|