C10H16FN — CID 146342859
4-fluoro-N-[(Z)-pent-1-enyl]pent-1-en-3-imine (PubChem CID 146342859) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is 4-fluoro-N-[(Z)-pent-1-enyl]pent-1-en-3-imine.
| Compound Name | 4-fluoro-N-[(Z)-pent-1-enyl]pent-1-en-3-imine |
|---|---|
| PubChem CID | 146342859 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 4-fluoro-N-[(Z)-pent-1-enyl]pent-1-en-3-imine |
| SMILES | C=C/C(=N\C=C/CCC)C(C)F |
| InChI | InChI=1S/C10H16FN/c1-4-6-7-8-12-10(5-2)9(3)11/h5,7-9H,2,4,6H2,1,3H3/b8-7-,12-10+ |
| InChIKey | KODMGSNVNLQENO-QOUMFGDESA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|