C7H12N2 — CID 88570472
(Z)-3-N-methyl-1-N-methylidenepent-1-ene-1,3-diimine (PubChem CID 88570472) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (Z)-3-N-methyl-1-N-methylidenepent-1-ene-1,3-diimine.
| Compound Name | (Z)-3-N-methyl-1-N-methylidenepent-1-ene-1,3-diimine |
|---|---|
| PubChem CID | 88570472 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (Z)-3-N-methyl-1-N-methylidenepent-1-ene-1,3-diimine |
| SMILES | C=N/C=C\C(CC)=N\C |
| InChI | InChI=1S/C7H12N2/c1-4-7(9-3)5-6-8-2/h5-6H,2,4H2,1,3H3/b6-5-,9-7+ |
| InChIKey | WGWQQVQRWKJAIV-BZWSEGBZSA-N |
| XLogP | 1.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|