C67H106N7O18Si-2 — CID 145149646
CID 145149646 (PubChem CID 145149646) has the molecular formula C67H106N7O18Si-2 and a molecular weight of 1325.70 g/mol.
| Compound Name | CID 145149646 |
|---|---|
| PubChem CID | 145149646 |
| Molecular Formula | C67H106N7O18Si-2 |
| Molecular Weight | 1325.70 g/mol |
| Exact Mass | 1324.74 |
| IUPAC Name | — |
| SMILES | C=C(c1ccccc1)[C@H](C(=O)N(C)CC(=O)N[C@H](C(=O)N[C@H](C)C(=O)[O-])C(C)CC)N(C)C(=O)[C@H](C)NC(=O)[C@@H](CC(C)C)OC(=O)/C(C)=C/C(N)(CCO[Si-](CCC)(CCC)OCCOCCOCCOCCN1C(=O)C=CC1=O)C[C@H](OC=O)[C@H](C)C/C(C)=C/C |
| InChI | InChI=1S/C67H107N7O18Si/c1-16-37-93(38-17-2,91-36-35-88-34-33-87-32-31-86-30-28-74-57(77)25-26-58(74)78)90-29-27-67(68,42-55(89-44-75)48(9)40-46(7)18-3)41-49(10)66(85)92-54(39-45(5)6)61(79)69-51(12)63(81)73(15)60(50(11)53-23-21-20-22-24-53)64(82)72(14)43-56(76)71-59(47(8)19-4)62(80)70-52(13)65(83)84/h18,20-26,41,44-45,47-48,51-52,54-55,59-60H,11,16-17,19,27-40,42-43,68H2,1-10,12-15H3,(H,69,79)(H,70,80)(H,71,76)(H,83,84)/q-1/p-1/b46-18+,49-41+/t47?,48-,51+,52-,54-,55+,59+,60-,67?/m1/s1 |
| InChIKey | RQJHLCRUYJLFCB-OLQGMUSJSA-M |
| XLogP | 4.46 |
| TPSA | 330.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1325.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|