C10H19N5O4S — CID 145150650
2-[[[3-(1-aminopropyl)-1,2,4-oxadiazol-5-yl]methylamino]sulfanylamino]-3-hydroxybutanoic acid (PubChem CID 145150650) has the molecular formula C10H19N5O4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[[[3-(1-aminopropyl)-1,2,4-oxadiazol-5-yl]methylamino]sulfanylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[[3-(1-aminopropyl)-1,2,4-oxadiazol-5-yl]methylamino]sulfanylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 145150650 |
| Molecular Formula | C10H19N5O4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[[[3-(1-aminopropyl)-1,2,4-oxadiazol-5-yl]methylamino]sulfanylamino]-3-hydroxybutanoic acid |
| SMILES | CCC(N)c1noc(CNSNC(C(=O)O)C(C)O)n1 |
| InChI | InChI=1S/C10H19N5O4S/c1-3-6(11)9-13-7(19-14-9)4-12-20-15-8(5(2)16)10(17)18/h5-6,8,12,15-16H,3-4,11H2,1-2H3,(H,17,18) |
| InChIKey | OHCKBLIQYQZGMG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|