C7H13N5O2S — CID 166862692
1-[5-[(ethylsulfanylamino)methyl]-1,2,4-oxadiazol-3-yl]-2-nitrosoethanamine (PubChem CID 166862692) has the molecular formula C7H13N5O2S and a molecular weight of 231.28 g/mol. Its IUPAC name is 1-[5-[(ethylsulfanylamino)methyl]-1,2,4-oxadiazol-3-yl]-2-nitrosoethanamine.
| Compound Name | 1-[5-[(ethylsulfanylamino)methyl]-1,2,4-oxadiazol-3-yl]-2-nitrosoethanamine |
|---|---|
| PubChem CID | 166862692 |
| Molecular Formula | C7H13N5O2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-[5-[(ethylsulfanylamino)methyl]-1,2,4-oxadiazol-3-yl]-2-nitrosoethanamine |
| SMILES | CCSNCc1nc(C(N)CN=O)no1 |
| InChI | InChI=1S/C7H13N5O2S/c1-2-15-10-4-6-11-7(12-14-6)5(8)3-9-13/h5,10H,2-4,8H2,1H3 |
| InChIKey | PYVAZXUOHLRKFC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|