C14H28N6O5S — CID 145150941
2-[[[5-(1-amino-2-methylbutyl)-1,3,4-oxadiazol-2-yl]methylamino]sulfanylamino]-3-hydroxypropanoic acid;propanamide (PubChem CID 145150941) has the molecular formula C14H28N6O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[[[5-(1-amino-2-methylbutyl)-1,3,4-oxadiazol-2-yl]methylamino]sulfanylamino]-3-hydroxypropanoic acid;propanamide.
| Compound Name | 2-[[[5-(1-amino-2-methylbutyl)-1,3,4-oxadiazol-2-yl]methylamino]sulfanylamino]-3-hydroxypropanoic acid;propanamide |
|---|---|
| PubChem CID | 145150941 |
| Molecular Formula | C14H28N6O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[[[5-(1-amino-2-methylbutyl)-1,3,4-oxadiazol-2-yl]methylamino]sulfanylamino]-3-hydroxypropanoic acid;propanamide |
| SMILES | CCC(C)C(N)c1nnc(CNSNC(CO)C(=O)O)o1.CCC(N)=O |
| InChI | InChI=1S/C11H21N5O4S.C3H7NO/c1-3-6(2)9(12)10-15-14-8(20-10)4-13-21-16-7(5-17)11(18)19;1-2-3(4)5/h6-7,9,13,16-17H,3-5,12H2,1-2H3,(H,18,19);2H2,1H3,(H2,4,5) |
| InChIKey | NAAFPBASGBOUTP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 189.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|