C14H14F3N5O — CID 145153348
5-[(Z)-3-iminobut-1-enyl]-N-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide (PubChem CID 145153348) has the molecular formula C14H14F3N5O and a molecular weight of 325.29 g/mol. Its IUPAC name is 5-[(Z)-3-iminobut-1-enyl]-N-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 5-[(Z)-3-iminobut-1-enyl]-N-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 145153348 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-[(Z)-3-iminobut-1-enyl]-N-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide |
| SMILES | [H]/N=C(C)/C=C\c1ccc(C(=O)Nc2cn(C)nc2C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C14H14F3N5O/c1-8(18)3-4-9-5-6-10(19-9)13(23)20-11-7-22(2)21-12(11)14(15,16)17/h3-7,18-19H,1-2H3,(H,20,23)/b4-3-,18-8+ |
| InChIKey | YIZVROSEISYWLM-BCQBIFAWSA-N |
| XLogP | 3.07 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|