C22H26F2N8O — CID 145153432
N-[3-(1,1-difluoroethyl)-1-methylpyrazol-4-yl]-2-[(3S)-2-prop-1-en-2-yl-4,7-diazaspiro[2.5]octan-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 145153432) has the molecular formula C22H26F2N8O and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)-1-methylpyrazol-4-yl]-2-[(3S)-2-prop-1-en-2-yl-4,7-diazaspiro[2.5]octan-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | N-[3-(1,1-difluoroethyl)-1-methylpyrazol-4-yl]-2-[(3S)-2-prop-1-en-2-yl-4,7-diazaspiro[2.5]octan-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 145153432 |
| Molecular Formula | C22H26F2N8O |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)-1-methylpyrazol-4-yl]-2-[(3S)-2-prop-1-en-2-yl-4,7-diazaspiro[2.5]octan-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | C=C(C)C1C[C@@]12CNCCN2c1ncc2ccc(C(=O)Nc3cn(C)nc3C(C)(F)F)n2n1 |
| InChI | InChI=1S/C22H26F2N8O/c1-13(2)15-9-22(15)12-25-7-8-31(22)20-26-10-14-5-6-17(32(14)29-20)19(33)27-16-11-30(4)28-18(16)21(3,23)24/h5-6,10-11,15,25H,1,7-9,12H2,2-4H3,(H,27,33)/t15?,22-/m1/s1 |
| InChIKey | MZZVNJUTHMUZLV-ZZAPORBBSA-N |
| XLogP | 2.57 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|