C35H39N3O9 — CID 145156581
2-amino-4-[5-[(10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]pentoxy]-5-methoxybenzoic acid;ethane (PubChem CID 145156581) has the molecular formula C35H39N3O9 and a molecular weight of 645.71 g/mol. Its IUPAC name is 2-amino-4-[5-[(10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]pentoxy]-5-methoxybenzoic acid;ethane.
| Compound Name | 2-amino-4-[5-[(10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]pentoxy]-5-methoxybenzoic acid;ethane |
|---|---|
| PubChem CID | 145156581 |
| Molecular Formula | C35H39N3O9 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 2-amino-4-[5-[(10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]pentoxy]-5-methoxybenzoic acid;ethane |
| SMILES | CC.CCc1c2c(nc3ccc(OCCCCCOc4cc(N)c(C(=O)O)cc4OC)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3O |
| InChI | InChI=1S/C33H33N3O9.C2H6/c1-3-18-19-11-17(43-9-5-4-6-10-44-28-14-24(34)21(32(39)40)13-27(28)42-2)7-8-25(19)35-29-22(18)15-36-26(29)12-20-23(31(36)38)16-45-33(41)30(20)37;1-2/h7-8,11-14,30,37H,3-6,9-10,15-16,34H2,1-2H3,(H,39,40);1-2H3 |
| InChIKey | XBYSNOCVNAKOKC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 172.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|