C29H28N4O9 — CID 144678841
[10-ethyl-19-[4-(methylamino)-4-oxobutanoyl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-amino-4-oxobutanoate (PubChem CID 144678841) has the molecular formula C29H28N4O9 and a molecular weight of 576.56 g/mol. Its IUPAC name is [10-ethyl-19-[4-(methylamino)-4-oxobutanoyl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-amino-4-oxobutanoate.
| Compound Name | [10-ethyl-19-[4-(methylamino)-4-oxobutanoyl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-amino-4-oxobutanoate |
|---|---|
| PubChem CID | 144678841 |
| Molecular Formula | C29H28N4O9 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | [10-ethyl-19-[4-(methylamino)-4-oxobutanoyl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-amino-4-oxobutanoate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)CCC(N)=O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3OC(=O)CCC(=O)NC |
| InChI | InChI=1S/C29H28N4O9/c1-3-15-16-10-14(41-24(36)8-6-22(30)34)4-5-20(16)32-26-18(15)12-33-21(26)11-17-19(28(33)38)13-40-29(39)27(17)42-25(37)9-7-23(35)31-2/h4-5,10-11,27H,3,6-9,12-13H2,1-2H3,(H2,30,34)(H,31,35) |
| InChIKey | QLAGYGWTPJGUKX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 185.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|