C27H34N4O6 — CID 163276336
2-[(10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]acetohydrazide;ethane;methanol (PubChem CID 163276336) has the molecular formula C27H34N4O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-[(10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]acetohydrazide;ethane;methanol.
| Compound Name | 2-[(10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]acetohydrazide;ethane;methanol |
|---|---|
| PubChem CID | 163276336 |
| Molecular Formula | C27H34N4O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 2-[(10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxy]acetohydrazide;ethane;methanol |
| SMILES | CC.CCc1c2c(nc3ccc(OCC(=O)NN)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3CC.CO |
| InChI | InChI=1S/C24H24N4O5.C2H6.CH4O/c1-3-13-16-7-12(32-11-21(29)27-25)5-6-19(16)26-22-17(13)9-28-20(22)8-15-14(4-2)24(31)33-10-18(15)23(28)30;2*1-2/h5-8,14H,3-4,9-11,25H2,1-2H3,(H,27,29);1-2H3;2H,1H3 |
| InChIKey | HUEZLJQRSSBTMY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|