C33H41N3O8 — CID 178153383
tert-butyl (10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate;methyl 2-(propan-2-ylamino)acetate (PubChem CID 178153383) has the molecular formula C33H41N3O8 and a molecular weight of 607.70 g/mol. Its IUPAC name is tert-butyl (10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate;methyl 2-(propan-2-ylamino)acetate.
| Compound Name | tert-butyl (10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate;methyl 2-(propan-2-ylamino)acetate |
|---|---|
| PubChem CID | 178153383 |
| Molecular Formula | C33H41N3O8 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | tert-butyl (10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) carbonate;methyl 2-(propan-2-ylamino)acetate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)OC(C)(C)C)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3CC.COC(=O)CNC(C)C |
| InChI | InChI=1S/C27H28N2O6.C6H13NO2/c1-6-15-18-10-14(34-26(32)35-27(3,4)5)8-9-21(18)28-23-19(15)12-29-22(23)11-17-16(7-2)25(31)33-13-20(17)24(29)30;1-5(2)7-4-6(8)9-3/h8-11,16H,6-7,12-13H2,1-5H3;5,7H,4H2,1-3H3 |
| InChIKey | IDQNEQXQGXERAF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|