C38H38N2O4Si — CID 167423937
(19R)-7-[tert-butyl(diphenyl)silyl]oxy-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 167423937) has the molecular formula C38H38N2O4Si and a molecular weight of 614.82 g/mol. Its IUPAC name is (19R)-7-[tert-butyl(diphenyl)silyl]oxy-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19R)-7-[tert-butyl(diphenyl)silyl]oxy-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 167423937 |
| Molecular Formula | C38H38N2O4Si |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | (19R)-7-[tert-butyl(diphenyl)silyl]oxy-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCc1c2c(nc3ccc(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@@H]3CC |
| InChI | InChI=1S/C38H38N2O4Si/c1-6-27-30-20-24(44-45(38(3,4)5,25-14-10-8-11-15-25)26-16-12-9-13-17-26)18-19-33(30)39-35-31(27)22-40-34(35)21-29-28(7-2)37(42)43-23-32(29)36(40)41/h8-21,28H,6-7,22-23H2,1-5H3/t28-/m1/s1 |
| InChIKey | NYQFYHYHVFTMII-MUUNZHRXSA-N |
| XLogP | 6.48 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|