C31H30N4O10 — CID 88935447
(2,5-dioxopyrrolidin-1-yl) 6-[[(19S)-10-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]oxycarbonylamino]hexanoate (PubChem CID 88935447) has the molecular formula C31H30N4O10 and a molecular weight of 618.60 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[(19S)-10-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]oxycarbonylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[(19S)-10-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 88935447 |
| Molecular Formula | C31H30N4O10 |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[(19S)-10-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]oxycarbonylamino]hexanoate |
| SMILES | CCc1c2c(nc3ccc(O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@H]3OC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C31H30N4O10/c1-2-17-18-12-16(36)7-8-22(18)33-27-20(17)14-34-23(27)13-19-21(29(34)40)15-43-30(41)28(19)44-31(42)32-11-5-3-4-6-26(39)45-35-24(37)9-10-25(35)38/h7-8,12-13,28,36H,2-6,9-11,14-15H2,1H3,(H,32,42)/t28-/m0/s1 |
| InChIKey | OACXQOYDSRYASB-NDEPHWFRSA-N |
| XLogP | 2.68 |
| TPSA | 183.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|