C35H43N3O6 — CID 161495388
[(19S)-10,19-diethyl-7-methyl-14,18-dioxo-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 161495388) has the molecular formula C35H43N3O6 and a molecular weight of 601.74 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-7-methyl-14,18-dioxo-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | [(19S)-10,19-diethyl-7-methyl-14,18-dioxo-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 161495388 |
| Molecular Formula | C35H43N3O6 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | [(19S)-10,19-diethyl-7-methyl-14,18-dioxo-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCc1c2c(nc3ccc(C)cc13)-c1cc3c(c(=O)n1C2)CCC(=O)[C@@]3(CC)OC(=O)CCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H43N3O6/c1-7-22-24-18-21(3)13-15-27(24)37-31-25(22)20-38-28(31)19-26-23(32(38)41)14-16-29(39)35(26,8-2)43-30(40)12-10-9-11-17-36-33(42)44-34(4,5)6/h13,15,18-19H,7-12,14,16-17,20H2,1-6H3,(H,36,42)/t35-/m0/s1 |
| InChIKey | WGCYZZCNAVZJAO-DHUJRADRSA-N |
| XLogP | 6.04 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|