C36H44N4O8 — CID 146388811
(10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) 2,2-dimethyl-4-[[2-(octanoylamino)acetyl]amino]butanoate (PubChem CID 146388811) has the molecular formula C36H44N4O8 and a molecular weight of 660.77 g/mol. Its IUPAC name is (10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) 2,2-dimethyl-4-[[2-(octanoylamino)acetyl]amino]butanoate.
| Compound Name | (10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) 2,2-dimethyl-4-[[2-(octanoylamino)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 146388811 |
| Molecular Formula | C36H44N4O8 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | (10-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl) 2,2-dimethyl-4-[[2-(octanoylamino)acetyl]amino]butanoate |
| SMILES | CCCCCCCC(=O)NCC(=O)NCCC(C)(C)C(=O)Oc1ccc2nc3c(c(CC)c2c1)Cn1c-3cc2c(c1=O)COC(=O)C2O |
| InChI | InChI=1S/C36H44N4O8/c1-5-7-8-9-10-11-29(41)38-18-30(42)37-15-14-36(3,4)35(46)48-21-12-13-27-23(16-21)22(6-2)25-19-40-28(31(25)39-27)17-24-26(33(40)44)20-47-34(45)32(24)43/h12-13,16-17,32,43H,5-11,14-15,18-20H2,1-4H3,(H,37,42)(H,38,41) |
| InChIKey | XESACUHEXPVSIY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|