About ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate
ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate (PubChem CID 145158245) has the molecular formula C27H27NO2S
and a molecular weight of 429.59 g/mol. Its IUPAC name is ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate |
| PubChem CID | 145158245 |
| Molecular Formula | C27H27NO2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate |
| SMILES | CC.COC(=O)C(C)(C)Cc1cc2c(-c3ccc(C#N)c4ccccc34)cccc2s1 |
| InChI | InChI=1S/C25H21NO2S.C2H6/c1-25(2,24(27)28-3)14-17-13-22-20(9-6-10-23(22)29-17)21-12-11-16(15-26)18-7-4-5-8-19(18)21;1-2/h4-13H,14H2,1-3H3;1-2H3 |
| InChIKey | PSOMFHKAQVCJDH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate?
The IUPAC name of ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate (CID 145158245) is ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate.
What is the SMILES notation for ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate?
The canonical SMILES for ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate is CC.COC(=O)C(C)(C)Cc1cc2c(-c3ccc(C#N)c4ccccc34)cccc2s1.
What is the InChIKey of ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate?
The InChIKey is PSOMFHKAQVCJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO2S.C2H6/c1-25(2,24(27)28-3)14-17-13-22-20(9-6-10-23(22)29-17)21-12-11-16(15-26)18-7-4-5-8-19(18)21;1-2/h4-13H,14H2,1-3H3;1-2H3.
What are the key properties of ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate?
ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate has a molecular weight of 429.59 g/mol, XLogP of 7.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-dimethylpropanoate is sourced from PubChem (CID 145158245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).