C12H11ClFN — CID 145162234
N-[(1E,3E)-4-chloro-2-(4-fluorophenyl)penta-1,3-dienyl]methanimine (PubChem CID 145162234) has the molecular formula C12H11ClFN and a molecular weight of 223.68 g/mol. Its IUPAC name is N-[(1E,3E)-4-chloro-2-(4-fluorophenyl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-4-chloro-2-(4-fluorophenyl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 145162234 |
| Molecular Formula | C12H11ClFN |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-[(1E,3E)-4-chloro-2-(4-fluorophenyl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H11ClFN/c1-9(13)7-11(8-15-2)10-3-5-12(14)6-4-10/h3-8H,2H2,1H3/b9-7+,11-8+ |
| InChIKey | RJXFIMBEPWVTLU-BIZFVBGRSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|