C14H14FNO — CID 143779389
(Z,3Z)-1-(4-fluorophenyl)-3-[(methylideneamino)methylidene]hex-4-en-1-one (PubChem CID 143779389) has the molecular formula C14H14FNO and a molecular weight of 231.27 g/mol. Its IUPAC name is (Z,3Z)-1-(4-fluorophenyl)-3-[(methylideneamino)methylidene]hex-4-en-1-one.
| Compound Name | (Z,3Z)-1-(4-fluorophenyl)-3-[(methylideneamino)methylidene]hex-4-en-1-one |
|---|---|
| PubChem CID | 143779389 |
| Molecular Formula | C14H14FNO |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (Z,3Z)-1-(4-fluorophenyl)-3-[(methylideneamino)methylidene]hex-4-en-1-one |
| SMILES | C=N/C=C(\C=C/C)CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FNO/c1-3-4-11(10-16-2)9-14(17)12-5-7-13(15)8-6-12/h3-8,10H,2,9H2,1H3/b4-3-,11-10+ |
| InChIKey | UJTMJXCMSJRHOV-CSWDMDPZSA-N |
| XLogP | 3.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|