C29H29N5O3 — CID 145164316
1-(1H-indazol-4-ylmethyl)-4-(5-methoxy-1H-indole-2-carbonyl)piperazin-2-one;toluene (PubChem CID 145164316) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is 1-(1H-indazol-4-ylmethyl)-4-(5-methoxy-1H-indole-2-carbonyl)piperazin-2-one;toluene.
| Compound Name | 1-(1H-indazol-4-ylmethyl)-4-(5-methoxy-1H-indole-2-carbonyl)piperazin-2-one;toluene |
|---|---|
| PubChem CID | 145164316 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-(1H-indazol-4-ylmethyl)-4-(5-methoxy-1H-indole-2-carbonyl)piperazin-2-one;toluene |
| SMILES | COc1ccc2[nH]c(C(=O)N3CCN(Cc4cccc5[nH]ncc45)C(=O)C3)cc2c1.Cc1ccccc1 |
| InChI | InChI=1S/C22H21N5O3.C7H8/c1-30-16-5-6-18-15(9-16)10-20(24-18)22(29)27-8-7-26(21(28)13-27)12-14-3-2-4-19-17(14)11-23-25-19;1-7-5-3-2-4-6-7/h2-6,9-11,24H,7-8,12-13H2,1H3,(H,23,25);2-6H,1H3 |
| InChIKey | SNRQVCSSZZWEMJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |