C22H23N3O3 — CID 42467254
1-(1H-indole-2-carbonyl)-4-[(4-methoxyphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 42467254) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-(1H-indole-2-carbonyl)-4-[(4-methoxyphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | 1-(1H-indole-2-carbonyl)-4-[(4-methoxyphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42467254 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-(1H-indole-2-carbonyl)-4-[(4-methoxyphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | COc1ccc(CN2CCN(C(=O)c3cc4ccccc4[nH]3)CCC2=O)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-28-18-8-6-16(7-9-18)15-25-13-12-24(11-10-21(25)26)22(27)20-14-17-4-2-3-5-19(17)23-20/h2-9,14,23H,10-13,15H2,1H3 |
| InChIKey | VBFQIWXKIAQYDS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |