C16H22N2 — CID 145165460
ethane;3-[(1E)-4-methyl-1-(methylamino)penta-1,3-dien-2-yl]benzonitrile (PubChem CID 145165460) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is ethane;3-[(1E)-4-methyl-1-(methylamino)penta-1,3-dien-2-yl]benzonitrile.
| Compound Name | ethane;3-[(1E)-4-methyl-1-(methylamino)penta-1,3-dien-2-yl]benzonitrile |
|---|---|
| PubChem CID | 145165460 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | ethane;3-[(1E)-4-methyl-1-(methylamino)penta-1,3-dien-2-yl]benzonitrile |
| SMILES | CC.CN/C=C(\C=C(C)C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H16N2.C2H6/c1-11(2)7-14(10-16-3)13-6-4-5-12(8-13)9-15;1-2/h4-8,10,16H,1-3H3;1-2H3/b14-10+; |
| InChIKey | GBUFLZCVHIZSJM-KMZJGFRYSA-N |
| XLogP | 4.11 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|