About N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole)
N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) (PubChem CID 145166782) has the molecular formula C19H41N5O
and a molecular weight of 355.57 g/mol. Its IUPAC name is N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole).
Molecular Properties
| Compound Name | N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) |
| PubChem CID | 145166782 |
| Molecular Formula | C19H41N5O |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.33 |
| IUPAC Name | N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) |
| SMILES | CC.CC.CCN(CC)CCOC.Cn1ccnc1.Cn1ccnc1 |
| InChI | InChI=1S/C7H17NO.2C4H6N2.2C2H6/c1-4-8(5-2)6-7-9-3;2*1-6-3-2-5-4-6;2*1-2/h4-7H2,1-3H3;2*2-4H,1H3;2*1-2H3 |
| InChIKey | PRNCVCISPPIFMS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole)?
The IUPAC name of N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) (CID 145166782) is N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole).
What is the SMILES notation for N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole)?
The canonical SMILES for N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) is CC.CC.CCN(CC)CCOC.Cn1ccnc1.Cn1ccnc1.
What is the InChIKey of N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole)?
The InChIKey is PRNCVCISPPIFMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO.2C4H6N2.2C2H6/c1-4-8(5-2)6-7-9-3;2*1-6-3-2-5-4-6;2*1-2/h4-7H2,1-3H3;2*2-4H,1H3;2*1-2H3.
What are the key properties of N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole)?
N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) has a molecular weight of 355.57 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-methoxyethanamine;ethane;bis(1-methylimidazole) is sourced from PubChem (CID 145166782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).