C21H25N5O3 — CID 145168143
1-[3-formyl-3-[1-hydroxy-2-(methylamino)ethyl]piperidin-1-yl]-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 145168143) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[3-formyl-3-[1-hydroxy-2-(methylamino)ethyl]piperidin-1-yl]-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 1-[3-formyl-3-[1-hydroxy-2-(methylamino)ethyl]piperidin-1-yl]-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 145168143 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[3-formyl-3-[1-hydroxy-2-(methylamino)ethyl]piperidin-1-yl]-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | CNCC(O)C1(C=O)CCCN(c2ncc(C(N)=O)c3[nH]c4ccccc4c23)C1 |
| InChI | InChI=1S/C21H25N5O3/c1-23-10-16(28)21(12-27)7-4-8-26(11-21)20-17-13-5-2-3-6-15(13)25-18(17)14(9-24-20)19(22)29/h2-3,5-6,9,12,16,23,25,28H,4,7-8,10-11H2,1H3,(H2,22,29) |
| InChIKey | BNPQWTRADVXLPR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|