C20H20N4O3 — CID 145166461
1-(4-hydroxy-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde (PubChem CID 145166461) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-(4-hydroxy-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde.
| Compound Name | 1-(4-hydroxy-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde |
|---|---|
| PubChem CID | 145166461 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-(4-hydroxy-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde |
| SMILES | O=Cc1cnc(N2CCCC3(C2)C(=O)NCC3O)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C20H20N4O3/c25-10-12-8-21-18(16-13-4-1-2-5-14(13)23-17(12)16)24-7-3-6-20(11-24)15(26)9-22-19(20)27/h1-2,4-5,8,10,15,23,26H,3,6-7,9,11H2,(H,22,27) |
| InChIKey | RDEKAAZEWMJYJZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|